About 4-Carboxy-1,2,3-triazole-5-thiol trisodium salt
4-Carboxy-1,2,3-triazole-5-thiol trisodium salt (PubChem CID 70603934) has the molecular formula C3H3N3Na3O2S
and a molecular weight of 214.11 g/mol.
Molecular Properties
| Compound Name | 4-Carboxy-1,2,3-triazole-5-thiol trisodium salt |
| PubChem CID | 70603934 |
| Molecular Formula | C3H3N3Na3O2S |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 213.96 |
| IUPAC Name | — |
| SMILES | O=C(O)c1n[nH][nH]c1=S.[Na].[Na].[Na] |
| InChI | InChI=1S/C3H3N3O2S.3Na/c7-3(8)1-2(9)5-6-4-1;;;/h(H,7,8)(H2,4,5,6,9);;; |
| InChIKey | BMJOWKWBBKBDSX-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-Carboxy-1,2,3-triazole-5-thiol trisodium salt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Carboxy-1,2,3-triazole-5-thiol trisodium salt?
The IUPAC name of 4-Carboxy-1,2,3-triazole-5-thiol trisodium salt (CID 70603934) is not available.
What is the SMILES notation for 4-Carboxy-1,2,3-triazole-5-thiol trisodium salt?
The canonical SMILES for 4-Carboxy-1,2,3-triazole-5-thiol trisodium salt is O=C(O)c1n[nH][nH]c1=S.[Na].[Na].[Na].
What is the InChIKey of 4-Carboxy-1,2,3-triazole-5-thiol trisodium salt?
The InChIKey is BMJOWKWBBKBDSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N3O2S.3Na/c7-3(8)1-2(9)5-6-4-1;;;/h(H,7,8)(H2,4,5,6,9);;;.
What are the key properties of 4-Carboxy-1,2,3-triazole-5-thiol trisodium salt?
4-Carboxy-1,2,3-triazole-5-thiol trisodium salt has a molecular weight of 214.11 g/mol, XLogP of -0.98, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Carboxy-1,2,3-triazole-5-thiol trisodium salt is sourced from PubChem (CID 70603934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).