C19H33NO2 — CID 70604885
(2,6-diethyl-2,3,6-trimethyl-1-prop-2-enylpiperidin-4-yl) (E)-but-2-enoate (PubChem CID 70604885) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is (2,6-diethyl-2,3,6-trimethyl-1-prop-2-enylpiperidin-4-yl) (E)-but-2-enoate.
| Compound Name | (2,6-diethyl-2,3,6-trimethyl-1-prop-2-enylpiperidin-4-yl) (E)-but-2-enoate |
|---|---|
| PubChem CID | 70604885 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | (2,6-diethyl-2,3,6-trimethyl-1-prop-2-enylpiperidin-4-yl) (E)-but-2-enoate |
| SMILES | C=CCN1C(C)(CC)CC(OC(=O)/C=C/C)C(C)C1(C)CC |
| InChI | InChI=1S/C19H33NO2/c1-8-12-17(21)22-16-14-18(6,10-3)20(13-9-2)19(7,11-4)15(16)5/h8-9,12,15-16H,2,10-11,13-14H2,1,3-7H3/b12-8+ |
| InChIKey | QGYZKBULKKYBAA-XYOKQWHBSA-N |
| XLogP | 4.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|