C25H33NO — CID 70604953
3-[6-methyl-2-[1-(4-methylphenyl)ethyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenol (PubChem CID 70604953) has the molecular formula C25H33NO and a molecular weight of 363.55 g/mol. Its IUPAC name is 3-[6-methyl-2-[1-(4-methylphenyl)ethyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenol.
| Compound Name | 3-[6-methyl-2-[1-(4-methylphenyl)ethyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenol |
|---|---|
| PubChem CID | 70604953 |
| Molecular Formula | C25H33NO |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | 3-[6-methyl-2-[1-(4-methylphenyl)ethyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenol |
| SMILES | Cc1ccc(C(C)N2CCC3(c4cccc(O)c4)CC(C)CCC3C2)cc1 |
| InChI | InChI=1S/C25H33NO/c1-18-7-10-21(11-8-18)20(3)26-14-13-25(22-5-4-6-24(27)15-22)16-19(2)9-12-23(25)17-26/h4-8,10-11,15,19-20,23,27H,9,12-14,16-17H2,1-3H3 |
| InChIKey | SKFOGEULDNQBGY-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |