C23H21BrN6O4S — CID 70605207
(3-bromophenyl) 3-[[(5R)-3,3-dimethyl-7-oxo-2-(2H-tetrazol-5-yl)-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]amino]-3-oxo-2-phenylpropanoate (PubChem CID 70605207) has the molecular formula C23H21BrN6O4S and a molecular weight of 557.43 g/mol. Its IUPAC name is (3-bromophenyl) 3-[[(5R)-3,3-dimethyl-7-oxo-2-(2H-tetrazol-5-yl)-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]amino]-3-oxo-2-phenylpropanoate.
| Compound Name | (3-bromophenyl) 3-[[(5R)-3,3-dimethyl-7-oxo-2-(2H-tetrazol-5-yl)-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]amino]-3-oxo-2-phenylpropanoate |
|---|---|
| PubChem CID | 70605207 |
| Molecular Formula | C23H21BrN6O4S |
| Molecular Weight | 557.43 g/mol |
| Exact Mass | 556.05 |
| IUPAC Name | (3-bromophenyl) 3-[[(5R)-3,3-dimethyl-7-oxo-2-(2H-tetrazol-5-yl)-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]amino]-3-oxo-2-phenylpropanoate |
| SMILES | CC1(C)S[C@@H]2C(NC(=O)C(C(=O)Oc3cccc(Br)c3)c3ccccc3)C(=O)N2C1c1nn[nH]n1 |
| InChI | InChI=1S/C23H21BrN6O4S/c1-23(2)17(18-26-28-29-27-18)30-20(32)16(21(30)35-23)25-19(31)15(12-7-4-3-5-8-12)22(33)34-14-10-6-9-13(24)11-14/h3-11,15-17,21H,1-2H3,(H,25,31)(H,26,27,28,29)/t15?,16?,17?,21-/m1/s1 |
| InChIKey | RZXIGFMEVVKPEC-TXRRYJPOSA-N |
| XLogP | 2.57 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|