About 5-[bis(4-chlorophenyl)methyl]pyridine-2-carboxylic acid;piperazine
5-[bis(4-chlorophenyl)methyl]pyridine-2-carboxylic acid;piperazine (PubChem CID 70605419) has the molecular formula C23H23Cl2N3O2
and a molecular weight of 444.36 g/mol. Its IUPAC name is 5-[bis(4-chlorophenyl)methyl]pyridine-2-carboxylic acid;piperazine.
Molecular Properties
| Compound Name | 5-[bis(4-chlorophenyl)methyl]pyridine-2-carboxylic acid;piperazine |
| PubChem CID | 70605419 |
| Molecular Formula | C23H23Cl2N3O2 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 5-[bis(4-chlorophenyl)methyl]pyridine-2-carboxylic acid;piperazine |
| SMILES | C1CNCCN1.O=C(O)c1ccc(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C19H13Cl2NO2.C4H10N2/c20-15-6-1-12(2-7-15)18(13-3-8-16(21)9-4-13)14-5-10-17(19(23)24)22-11-14;1-2-6-4-3-5-1/h1-11,18H,(H,23,24);5-6H,1-4H2 |
| InChIKey | HRXUWFKSXOZWIH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[bis(4-chlorophenyl)methyl]pyridine-2-carboxylic acid;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[bis(4-chlorophenyl)methyl]pyridine-2-carboxylic acid;piperazine?
The IUPAC name of 5-[bis(4-chlorophenyl)methyl]pyridine-2-carboxylic acid;piperazine (CID 70605419) is 5-[bis(4-chlorophenyl)methyl]pyridine-2-carboxylic acid;piperazine.
What is the SMILES notation for 5-[bis(4-chlorophenyl)methyl]pyridine-2-carboxylic acid;piperazine?
The canonical SMILES for 5-[bis(4-chlorophenyl)methyl]pyridine-2-carboxylic acid;piperazine is C1CNCCN1.O=C(O)c1ccc(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cn1.
What is the InChIKey of 5-[bis(4-chlorophenyl)methyl]pyridine-2-carboxylic acid;piperazine?
The InChIKey is HRXUWFKSXOZWIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13Cl2NO2.C4H10N2/c20-15-6-1-12(2-7-15)18(13-3-8-16(21)9-4-13)14-5-10-17(19(23)24)22-11-14;1-2-6-4-3-5-1/h1-11,18H,(H,23,24);5-6H,1-4H2.
What are the key properties of 5-[bis(4-chlorophenyl)methyl]pyridine-2-carboxylic acid;piperazine?
5-[bis(4-chlorophenyl)methyl]pyridine-2-carboxylic acid;piperazine has a molecular weight of 444.36 g/mol, XLogP of 4.45, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[bis(4-chlorophenyl)methyl]pyridine-2-carboxylic acid;piperazine is sourced from PubChem (CID 70605419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).