C21H34O3 — CID 70605480
(8R,9R,10S,13S,14S)-10-(hydroxymethyl)-4,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 70605480) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-10-(hydroxymethyl)-4,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9R,10S,13S,14S)-10-(hydroxymethyl)-4,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 70605480 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (8R,9R,10S,13S,14S)-10-(hydroxymethyl)-4,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CC1C2=CC[C@@H]3[C@@H](CC[C@@]4(C)[C@H]3CCC4(C)O)[C@@]2(CO)CCC1O |
| InChI | InChI=1S/C21H34O3/c1-13-15-5-4-14-16-7-10-20(3,24)19(16,2)9-6-17(14)21(15,12-22)11-8-18(13)23/h5,13-14,16-18,22-24H,4,6-12H2,1-3H3/t13?,14-,16-,17+,18?,19-,20?,21+/m0/s1 |
| InChIKey | NWSHRRXGLSFDJV-DRUQIDQYSA-N |
| XLogP | 3.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|