About 3,3-dimethyl-1,5-dioxacyclohexadecane-6,16-dione
3,3-dimethyl-1,5-dioxacyclohexadecane-6,16-dione (PubChem CID 70605767) has the molecular formula C16H28O4
and a molecular weight of 284.40 g/mol. Its IUPAC name is 3,3-dimethyl-1,5-dioxacyclohexadecane-6,16-dione.
Molecular Properties
| Compound Name | 3,3-dimethyl-1,5-dioxacyclohexadecane-6,16-dione |
| PubChem CID | 70605767 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 3,3-dimethyl-1,5-dioxacyclohexadecane-6,16-dione |
| SMILES | CC1(C)COC(=O)CCCCCCCCCC(=O)OC1 |
| InChI | InChI=1S/C16H28O4/c1-16(2)12-19-14(17)10-8-6-4-3-5-7-9-11-15(18)20-13-16/h3-13H2,1-2H3 |
| InChIKey | QSQJOYLUODMJNY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,3-dimethyl-1,5-dioxacyclohexadecane-6,16-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1,5-dioxacyclohexadecane-6,16-dione?
The IUPAC name of 3,3-dimethyl-1,5-dioxacyclohexadecane-6,16-dione (CID 70605767) is 3,3-dimethyl-1,5-dioxacyclohexadecane-6,16-dione.
What is the SMILES notation for 3,3-dimethyl-1,5-dioxacyclohexadecane-6,16-dione?
The canonical SMILES for 3,3-dimethyl-1,5-dioxacyclohexadecane-6,16-dione is CC1(C)COC(=O)CCCCCCCCCC(=O)OC1.
What is the InChIKey of 3,3-dimethyl-1,5-dioxacyclohexadecane-6,16-dione?
The InChIKey is QSQJOYLUODMJNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O4/c1-16(2)12-19-14(17)10-8-6-4-3-5-7-9-11-15(18)20-13-16/h3-13H2,1-2H3.
What are the key properties of 3,3-dimethyl-1,5-dioxacyclohexadecane-6,16-dione?
3,3-dimethyl-1,5-dioxacyclohexadecane-6,16-dione has a molecular weight of 284.40 g/mol, XLogP of 3.62, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1,5-dioxacyclohexadecane-6,16-dione is sourced from PubChem (CID 70605767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).