About 1-(6-chlorohexan-3-yl)-6,7-dimethoxy-1-methyl-4H-2,3-benzoxathiine
1-(6-chlorohexan-3-yl)-6,7-dimethoxy-1-methyl-4H-2,3-benzoxathiine (PubChem CID 70605990) has the molecular formula C17H25ClO3S
and a molecular weight of 344.90 g/mol. Its IUPAC name is 1-(6-chlorohexan-3-yl)-6,7-dimethoxy-1-methyl-4H-2,3-benzoxathiine.
Molecular Properties
| Compound Name | 1-(6-chlorohexan-3-yl)-6,7-dimethoxy-1-methyl-4H-2,3-benzoxathiine |
| PubChem CID | 70605990 |
| Molecular Formula | C17H25ClO3S |
| Molecular Weight | 344.90 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-(6-chlorohexan-3-yl)-6,7-dimethoxy-1-methyl-4H-2,3-benzoxathiine |
| SMILES | CCC(CCCCl)C1(C)OSCc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C17H25ClO3S/c1-5-13(7-6-8-18)17(2)14-10-16(20-4)15(19-3)9-12(14)11-22-21-17/h9-10,13H,5-8,11H2,1-4H3 |
| InChIKey | SOVXWIJUQILEQT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.90 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-chlorohexan-3-yl)-6,7-dimethoxy-1-methyl-4H-2,3-benzoxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chlorohexan-3-yl)-6,7-dimethoxy-1-methyl-4H-2,3-benzoxathiine?
The IUPAC name of 1-(6-chlorohexan-3-yl)-6,7-dimethoxy-1-methyl-4H-2,3-benzoxathiine (CID 70605990) is 1-(6-chlorohexan-3-yl)-6,7-dimethoxy-1-methyl-4H-2,3-benzoxathiine.
What is the SMILES notation for 1-(6-chlorohexan-3-yl)-6,7-dimethoxy-1-methyl-4H-2,3-benzoxathiine?
The canonical SMILES for 1-(6-chlorohexan-3-yl)-6,7-dimethoxy-1-methyl-4H-2,3-benzoxathiine is CCC(CCCCl)C1(C)OSCc2cc(OC)c(OC)cc21.
What is the InChIKey of 1-(6-chlorohexan-3-yl)-6,7-dimethoxy-1-methyl-4H-2,3-benzoxathiine?
The InChIKey is SOVXWIJUQILEQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25ClO3S/c1-5-13(7-6-8-18)17(2)14-10-16(20-4)15(19-3)9-12(14)11-22-21-17/h9-10,13H,5-8,11H2,1-4H3.
What are the key properties of 1-(6-chlorohexan-3-yl)-6,7-dimethoxy-1-methyl-4H-2,3-benzoxathiine?
1-(6-chlorohexan-3-yl)-6,7-dimethoxy-1-methyl-4H-2,3-benzoxathiine has a molecular weight of 344.90 g/mol, XLogP of 5.14, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chlorohexan-3-yl)-6,7-dimethoxy-1-methyl-4H-2,3-benzoxathiine is sourced from PubChem (CID 70605990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).