C31H46N2O4 — CID 70606153
4-[[6'-(4-aminobutoxy)-4,4,4',4',7,7'-hexamethyl-2,2'-spirobi[3H-chromene]-6-yl]oxy]butan-1-amine (PubChem CID 70606153) has the molecular formula C31H46N2O4 and a molecular weight of 510.72 g/mol. Its IUPAC name is 4-[[6'-(4-aminobutoxy)-4,4,4',4',7,7'-hexamethyl-2,2'-spirobi[3H-chromene]-6-yl]oxy]butan-1-amine.
| Compound Name | 4-[[6'-(4-aminobutoxy)-4,4,4',4',7,7'-hexamethyl-2,2'-spirobi[3H-chromene]-6-yl]oxy]butan-1-amine |
|---|---|
| PubChem CID | 70606153 |
| Molecular Formula | C31H46N2O4 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | 4-[[6'-(4-aminobutoxy)-4,4,4',4',7,7'-hexamethyl-2,2'-spirobi[3H-chromene]-6-yl]oxy]butan-1-amine |
| SMILES | Cc1cc2c(cc1OCCCCN)C(C)(C)CC1(CC(C)(C)c3cc(OCCCCN)c(C)cc3O1)O2 |
| InChI | InChI=1S/C31H46N2O4/c1-21-15-27-23(17-25(21)34-13-9-7-11-32)29(3,4)19-31(36-27)20-30(5,6)24-18-26(35-14-10-8-12-33)22(2)16-28(24)37-31/h15-18H,7-14,19-20,32-33H2,1-6H3 |
| InChIKey | CQLQXNZBNJJBIP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|