C22H33NO — CID 70606212
3-[(5aR,9aS)-3-hex-5-enyl-2,4,5,6,7,8,9,9a-octahydro-1H-benzo[d]azepin-5a-yl]phenol (PubChem CID 70606212) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is 3-[(5aR,9aS)-3-hex-5-enyl-2,4,5,6,7,8,9,9a-octahydro-1H-benzo[d]azepin-5a-yl]phenol.
| Compound Name | 3-[(5aR,9aS)-3-hex-5-enyl-2,4,5,6,7,8,9,9a-octahydro-1H-benzo[d]azepin-5a-yl]phenol |
|---|---|
| PubChem CID | 70606212 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | 3-[(5aR,9aS)-3-hex-5-enyl-2,4,5,6,7,8,9,9a-octahydro-1H-benzo[d]azepin-5a-yl]phenol |
| SMILES | C=CCCCCN1CC[C@@H]2CCCC[C@@]2(c2cccc(O)c2)CC1 |
| InChI | InChI=1S/C22H33NO/c1-2-3-4-7-15-23-16-12-19-9-5-6-13-22(19,14-17-23)20-10-8-11-21(24)18-20/h2,8,10-11,18-19,24H,1,3-7,9,12-17H2/t19-,22+/m0/s1 |
| InChIKey | HLQGDZPVNLDLAW-SIKLNZKXSA-N |
| XLogP | 5.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|