C15H22N2S — CID 70606377
N-(2,6-diethylphenyl)-3,4-dimethyl-1,3-thiazolidin-2-imine (PubChem CID 70606377) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-3,4-dimethyl-1,3-thiazolidin-2-imine.
| Compound Name | N-(2,6-diethylphenyl)-3,4-dimethyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 70606377 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-(2,6-diethylphenyl)-3,4-dimethyl-1,3-thiazolidin-2-imine |
| SMILES | CCc1cccc(CC)c1/N=C1\SCC(C)N1C |
| InChI | InChI=1S/C15H22N2S/c1-5-12-8-7-9-13(6-2)14(12)16-15-17(4)11(3)10-18-15/h7-9,11H,5-6,10H2,1-4H3/b16-15- |
| InChIKey | LEOKEBKETUXOHX-NXVVXOECSA-N |
| XLogP | 3.87 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|