C20H25NO4 — CID 70606417
[(1S,9R)-10-acetyloxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] acetate (PubChem CID 70606417) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is [(1S,9R)-10-acetyloxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] acetate.
| Compound Name | [(1S,9R)-10-acetyloxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] acetate |
|---|---|
| PubChem CID | 70606417 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | [(1S,9R)-10-acetyloxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)[C@@]13CCCCC1(OC(C)=O)[C@@H](C2)NCC3 |
| InChI | InChI=1S/C20H25NO4/c1-13(22)24-16-6-5-15-11-18-20(25-14(2)23)8-4-3-7-19(20,9-10-21-18)17(15)12-16/h5-6,12,18,21H,3-4,7-11H2,1-2H3/t18-,19+,20?/m1/s1 |
| InChIKey | PQAGRMMHQGMMKZ-LFPSWIHMSA-N |
| XLogP | 2.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|