About 2-(cyclohexen-1-yl)-1,3-thiazolidine-4-carbonitrile
2-(cyclohexen-1-yl)-1,3-thiazolidine-4-carbonitrile (PubChem CID 70606430) has the molecular formula C10H14N2S
and a molecular weight of 194.30 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1,3-thiazolidine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-(cyclohexen-1-yl)-1,3-thiazolidine-4-carbonitrile |
| PubChem CID | 70606430 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1,3-thiazolidine-4-carbonitrile |
| SMILES | N#CC1CSC(C2=CCCCC2)N1 |
| InChI | InChI=1S/C10H14N2S/c11-6-9-7-13-10(12-9)8-4-2-1-3-5-8/h4,9-10,12H,1-3,5,7H2 |
| InChIKey | YGBUZZSSRQCGOB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclohexen-1-yl)-1,3-thiazolidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexen-1-yl)-1,3-thiazolidine-4-carbonitrile?
The IUPAC name of 2-(cyclohexen-1-yl)-1,3-thiazolidine-4-carbonitrile (CID 70606430) is 2-(cyclohexen-1-yl)-1,3-thiazolidine-4-carbonitrile.
What is the SMILES notation for 2-(cyclohexen-1-yl)-1,3-thiazolidine-4-carbonitrile?
The canonical SMILES for 2-(cyclohexen-1-yl)-1,3-thiazolidine-4-carbonitrile is N#CC1CSC(C2=CCCCC2)N1.
What is the InChIKey of 2-(cyclohexen-1-yl)-1,3-thiazolidine-4-carbonitrile?
The InChIKey is YGBUZZSSRQCGOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2S/c11-6-9-7-13-10(12-9)8-4-2-1-3-5-8/h4,9-10,12H,1-3,5,7H2.
What are the key properties of 2-(cyclohexen-1-yl)-1,3-thiazolidine-4-carbonitrile?
2-(cyclohexen-1-yl)-1,3-thiazolidine-4-carbonitrile has a molecular weight of 194.30 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexen-1-yl)-1,3-thiazolidine-4-carbonitrile is sourced from PubChem (CID 70606430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).