C12H20BrNO3 — CID 7060653
(1R,2R,3S)-2-(bromomethyl)-3-(dimethylcarbamoyl)-1,2-dimethylcyclopentane-1-carboxylic acid (PubChem CID 7060653) has the molecular formula C12H20BrNO3 and a molecular weight of 306.20 g/mol. Its IUPAC name is (1R,2R,3S)-2-(bromomethyl)-3-(dimethylcarbamoyl)-1,2-dimethylcyclopentane-1-carboxylic acid.
| Compound Name | (1R,2R,3S)-2-(bromomethyl)-3-(dimethylcarbamoyl)-1,2-dimethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 7060653 |
| Molecular Formula | C12H20BrNO3 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | (1R,2R,3S)-2-(bromomethyl)-3-(dimethylcarbamoyl)-1,2-dimethylcyclopentane-1-carboxylic acid |
| SMILES | CN(C)C(=O)[C@H]1CC[C@@](C)(C(=O)O)[C@]1(C)CBr |
| InChI | InChI=1S/C12H20BrNO3/c1-11(10(16)17)6-5-8(9(15)14(3)4)12(11,2)7-13/h8H,5-7H2,1-4H3,(H,16,17)/t8-,11+,12-/m1/s1 |
| InChIKey | AJNCBTVQNLELOB-JFUSQASVSA-N |
| XLogP | 1.98 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|