C17H27NO — CID 70606607
(2R,3S)-3-[(1-methylpiperidin-2-yl)methyl]-1,2,3,4,5,8-hexahydronaphthalen-2-ol (PubChem CID 70606607) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is (2R,3S)-3-[(1-methylpiperidin-2-yl)methyl]-1,2,3,4,5,8-hexahydronaphthalen-2-ol.
| Compound Name | (2R,3S)-3-[(1-methylpiperidin-2-yl)methyl]-1,2,3,4,5,8-hexahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 70606607 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (2R,3S)-3-[(1-methylpiperidin-2-yl)methyl]-1,2,3,4,5,8-hexahydronaphthalen-2-ol |
| SMILES | CN1CCCCC1C[C@@H]1CC2=C(CC=CC2)C[C@H]1O |
| InChI | InChI=1S/C17H27NO/c1-18-9-5-4-8-16(18)11-15-10-13-6-2-3-7-14(13)12-17(15)19/h2-3,15-17,19H,4-12H2,1H3/t15-,16?,17+/m0/s1 |
| InChIKey | PBHUFRTUONBEGQ-RPCGPGEBSA-N |
| XLogP | 3.28 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|