About 5-bromo-4,6-dimethylpyridin-3-amine
5-bromo-4,6-dimethylpyridin-3-amine (PubChem CID 7060666) has the molecular formula C7H9BrN2
and a molecular weight of 201.07 g/mol. Its IUPAC name is 5-bromo-4,6-dimethylpyridin-3-amine.
Molecular Properties
| Compound Name | 5-bromo-4,6-dimethylpyridin-3-amine |
| PubChem CID | 7060666 |
| Molecular Formula | C7H9BrN2 |
| Molecular Weight | 201.07 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 5-bromo-4,6-dimethylpyridin-3-amine |
| SMILES | Cc1ncc(N)c(C)c1Br |
| InChI | InChI=1S/C7H9BrN2/c1-4-6(9)3-10-5(2)7(4)8/h3H,9H2,1-2H3 |
| InChIKey | OXKUDSPWEKACSJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.07 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-4,6-dimethylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4,6-dimethylpyridin-3-amine?
The IUPAC name of 5-bromo-4,6-dimethylpyridin-3-amine (CID 7060666) is 5-bromo-4,6-dimethylpyridin-3-amine.
What is the SMILES notation for 5-bromo-4,6-dimethylpyridin-3-amine?
The canonical SMILES for 5-bromo-4,6-dimethylpyridin-3-amine is Cc1ncc(N)c(C)c1Br.
What is the InChIKey of 5-bromo-4,6-dimethylpyridin-3-amine?
The InChIKey is OXKUDSPWEKACSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2/c1-4-6(9)3-10-5(2)7(4)8/h3H,9H2,1-2H3.
What are the key properties of 5-bromo-4,6-dimethylpyridin-3-amine?
5-bromo-4,6-dimethylpyridin-3-amine has a molecular weight of 201.07 g/mol, XLogP of 2.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4,6-dimethylpyridin-3-amine is sourced from PubChem (CID 7060666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).