About 3-chloro-5-(2,4-dichlorophenyl)-1,2-thiazole-4-carbonitrile
3-chloro-5-(2,4-dichlorophenyl)-1,2-thiazole-4-carbonitrile (PubChem CID 706068) has the molecular formula C10H3Cl3N2S
and a molecular weight of 289.57 g/mol. Its IUPAC name is 3-chloro-5-(2,4-dichlorophenyl)-1,2-thiazole-4-carbonitrile.
Molecular Properties
| Compound Name | 3-chloro-5-(2,4-dichlorophenyl)-1,2-thiazole-4-carbonitrile |
| PubChem CID | 706068 |
| Molecular Formula | C10H3Cl3N2S |
| Molecular Weight | 289.57 g/mol |
| Exact Mass | 287.91 |
| IUPAC Name | 3-chloro-5-(2,4-dichlorophenyl)-1,2-thiazole-4-carbonitrile |
| SMILES | N#Cc1c(Cl)nsc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H3Cl3N2S/c11-5-1-2-6(8(12)3-5)9-7(4-14)10(13)15-16-9/h1-3H |
| InChIKey | QIVNXKANLATELR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-5-(2,4-dichlorophenyl)-1,2-thiazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-(2,4-dichlorophenyl)-1,2-thiazole-4-carbonitrile?
The IUPAC name of 3-chloro-5-(2,4-dichlorophenyl)-1,2-thiazole-4-carbonitrile (CID 706068) is 3-chloro-5-(2,4-dichlorophenyl)-1,2-thiazole-4-carbonitrile.
What is the SMILES notation for 3-chloro-5-(2,4-dichlorophenyl)-1,2-thiazole-4-carbonitrile?
The canonical SMILES for 3-chloro-5-(2,4-dichlorophenyl)-1,2-thiazole-4-carbonitrile is N#Cc1c(Cl)nsc1-c1ccc(Cl)cc1Cl.
What is the InChIKey of 3-chloro-5-(2,4-dichlorophenyl)-1,2-thiazole-4-carbonitrile?
The InChIKey is QIVNXKANLATELR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H3Cl3N2S/c11-5-1-2-6(8(12)3-5)9-7(4-14)10(13)15-16-9/h1-3H.
What are the key properties of 3-chloro-5-(2,4-dichlorophenyl)-1,2-thiazole-4-carbonitrile?
3-chloro-5-(2,4-dichlorophenyl)-1,2-thiazole-4-carbonitrile has a molecular weight of 289.57 g/mol, XLogP of 4.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-(2,4-dichlorophenyl)-1,2-thiazole-4-carbonitrile is sourced from PubChem (CID 706068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).