C10H12O7 — CID 70607129
2-[(1S,4R)-4-hydroxycyclopent-2-en-1-yl]oxy-2H-pyran-3,4,5,6-tetrol (PubChem CID 70607129) has the molecular formula C10H12O7 and a molecular weight of 244.20 g/mol. Its IUPAC name is 2-[(1S,4R)-4-hydroxycyclopent-2-en-1-yl]oxy-2H-pyran-3,4,5,6-tetrol.
| Compound Name | 2-[(1S,4R)-4-hydroxycyclopent-2-en-1-yl]oxy-2H-pyran-3,4,5,6-tetrol |
|---|---|
| PubChem CID | 70607129 |
| Molecular Formula | C10H12O7 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2-[(1S,4R)-4-hydroxycyclopent-2-en-1-yl]oxy-2H-pyran-3,4,5,6-tetrol |
| SMILES | OC1=C(O)C(O)=C(O)C(O[C@@H]2C=C[C@H](O)C2)O1 |
| InChI | InChI=1S/C10H12O7/c11-4-1-2-5(3-4)16-10-8(14)6(12)7(13)9(15)17-10/h1-2,4-5,10-15H,3H2/t4-,5+,10?/m0/s1 |
| InChIKey | DRMUQPOKMYXMBV-YXQJYQJSSA-N |
| XLogP | 0.66 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|