About 2-[5-[2-oxo-2-(prop-2-enylamino)ethyl]-1,2,4-oxadiazol-3-yl]acetic acid
2-[5-[2-oxo-2-(prop-2-enylamino)ethyl]-1,2,4-oxadiazol-3-yl]acetic acid (PubChem CID 70608092) has the molecular formula C9H11N3O4
and a molecular weight of 225.20 g/mol. Its IUPAC name is 2-[5-[2-oxo-2-(prop-2-enylamino)ethyl]-1,2,4-oxadiazol-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[5-[2-oxo-2-(prop-2-enylamino)ethyl]-1,2,4-oxadiazol-3-yl]acetic acid |
| PubChem CID | 70608092 |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2-[5-[2-oxo-2-(prop-2-enylamino)ethyl]-1,2,4-oxadiazol-3-yl]acetic acid |
| SMILES | C=CCNC(=O)Cc1nc(CC(=O)O)no1 |
| InChI | InChI=1S/C9H11N3O4/c1-2-3-10-7(13)5-8-11-6(12-16-8)4-9(14)15/h2H,1,3-5H2,(H,10,13)(H,14,15) |
| InChIKey | GZSVXIAOBDEXIJ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-[2-oxo-2-(prop-2-enylamino)ethyl]-1,2,4-oxadiazol-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[2-oxo-2-(prop-2-enylamino)ethyl]-1,2,4-oxadiazol-3-yl]acetic acid?
The IUPAC name of 2-[5-[2-oxo-2-(prop-2-enylamino)ethyl]-1,2,4-oxadiazol-3-yl]acetic acid (CID 70608092) is 2-[5-[2-oxo-2-(prop-2-enylamino)ethyl]-1,2,4-oxadiazol-3-yl]acetic acid.
What is the SMILES notation for 2-[5-[2-oxo-2-(prop-2-enylamino)ethyl]-1,2,4-oxadiazol-3-yl]acetic acid?
The canonical SMILES for 2-[5-[2-oxo-2-(prop-2-enylamino)ethyl]-1,2,4-oxadiazol-3-yl]acetic acid is C=CCNC(=O)Cc1nc(CC(=O)O)no1.
What is the InChIKey of 2-[5-[2-oxo-2-(prop-2-enylamino)ethyl]-1,2,4-oxadiazol-3-yl]acetic acid?
The InChIKey is GZSVXIAOBDEXIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O4/c1-2-3-10-7(13)5-8-11-6(12-16-8)4-9(14)15/h2H,1,3-5H2,(H,10,13)(H,14,15).
What are the key properties of 2-[5-[2-oxo-2-(prop-2-enylamino)ethyl]-1,2,4-oxadiazol-3-yl]acetic acid?
2-[5-[2-oxo-2-(prop-2-enylamino)ethyl]-1,2,4-oxadiazol-3-yl]acetic acid has a molecular weight of 225.20 g/mol, XLogP of -0.46, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[2-oxo-2-(prop-2-enylamino)ethyl]-1,2,4-oxadiazol-3-yl]acetic acid is sourced from PubChem (CID 70608092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).