C9H9ClN4 — CID 70608161
6-(2-chlorophenyl)-2-methyl-1H-1,2,4,5-tetrazine (PubChem CID 70608161) has the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-2-methyl-1H-1,2,4,5-tetrazine.
| Compound Name | 6-(2-chlorophenyl)-2-methyl-1H-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 70608161 |
| Molecular Formula | C9H9ClN4 |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 6-(2-chlorophenyl)-2-methyl-1H-1,2,4,5-tetrazine |
| SMILES | CN1C=NN=C(c2ccccc2Cl)N1 |
| InChI | InChI=1S/C9H9ClN4/c1-14-6-11-12-9(13-14)7-4-2-3-5-8(7)10/h2-6H,1H3,(H,12,13) |
| InChIKey | RNOCUBWRDOLRPT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |