About 6-(1,3-benzodioxol-5-yl)-5-cyclopropyl-4-oxo-1H-pyridine-3-carboxylic acid
6-(1,3-benzodioxol-5-yl)-5-cyclopropyl-4-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 70608438) has the molecular formula C16H13NO5
and a molecular weight of 299.28 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-5-cyclopropyl-4-oxo-1H-pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-(1,3-benzodioxol-5-yl)-5-cyclopropyl-4-oxo-1H-pyridine-3-carboxylic acid |
| PubChem CID | 70608438 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-5-cyclopropyl-4-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c(-c2ccc3c(c2)OCO3)c(C2CC2)c1=O |
| InChI | InChI=1S/C16H13NO5/c18-15-10(16(19)20)6-17-14(13(15)8-1-2-8)9-3-4-11-12(5-9)22-7-21-11/h3-6,8H,1-2,7H2,(H,17,18)(H,19,20) |
| InChIKey | NOMWCJUPFAGISV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(1,3-benzodioxol-5-yl)-5-cyclopropyl-4-oxo-1H-pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-benzodioxol-5-yl)-5-cyclopropyl-4-oxo-1H-pyridine-3-carboxylic acid?
The IUPAC name of 6-(1,3-benzodioxol-5-yl)-5-cyclopropyl-4-oxo-1H-pyridine-3-carboxylic acid (CID 70608438) is 6-(1,3-benzodioxol-5-yl)-5-cyclopropyl-4-oxo-1H-pyridine-3-carboxylic acid.
What is the SMILES notation for 6-(1,3-benzodioxol-5-yl)-5-cyclopropyl-4-oxo-1H-pyridine-3-carboxylic acid?
The canonical SMILES for 6-(1,3-benzodioxol-5-yl)-5-cyclopropyl-4-oxo-1H-pyridine-3-carboxylic acid is O=C(O)c1c[nH]c(-c2ccc3c(c2)OCO3)c(C2CC2)c1=O.
What is the InChIKey of 6-(1,3-benzodioxol-5-yl)-5-cyclopropyl-4-oxo-1H-pyridine-3-carboxylic acid?
The InChIKey is NOMWCJUPFAGISV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO5/c18-15-10(16(19)20)6-17-14(13(15)8-1-2-8)9-3-4-11-12(5-9)22-7-21-11/h3-6,8H,1-2,7H2,(H,17,18)(H,19,20).
What are the key properties of 6-(1,3-benzodioxol-5-yl)-5-cyclopropyl-4-oxo-1H-pyridine-3-carboxylic acid?
6-(1,3-benzodioxol-5-yl)-5-cyclopropyl-4-oxo-1H-pyridine-3-carboxylic acid has a molecular weight of 299.28 g/mol, XLogP of 2.35, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-benzodioxol-5-yl)-5-cyclopropyl-4-oxo-1H-pyridine-3-carboxylic acid is sourced from PubChem (CID 70608438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).