About 1-cyclopentyl-1,8-bis(2-methoxypropan-2-yloxy)octane-2,5-dione
1-cyclopentyl-1,8-bis(2-methoxypropan-2-yloxy)octane-2,5-dione (PubChem CID 70609044) has the molecular formula C21H38O6
and a molecular weight of 386.53 g/mol. Its IUPAC name is 1-cyclopentyl-1,8-bis(2-methoxypropan-2-yloxy)octane-2,5-dione.
Molecular Properties
| Compound Name | 1-cyclopentyl-1,8-bis(2-methoxypropan-2-yloxy)octane-2,5-dione |
| PubChem CID | 70609044 |
| Molecular Formula | C21H38O6 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 1-cyclopentyl-1,8-bis(2-methoxypropan-2-yloxy)octane-2,5-dione |
| SMILES | COC(C)(C)OCCCC(=O)CCC(=O)C(OC(C)(C)OC)C1CCCC1 |
| InChI | InChI=1S/C21H38O6/c1-20(2,24-5)26-15-9-12-17(22)13-14-18(23)19(16-10-7-8-11-16)27-21(3,4)25-6/h16,19H,7-15H2,1-6H3 |
| InChIKey | MJDPFTFUPTYPKX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyl-1,8-bis(2-methoxypropan-2-yloxy)octane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-1,8-bis(2-methoxypropan-2-yloxy)octane-2,5-dione?
The IUPAC name of 1-cyclopentyl-1,8-bis(2-methoxypropan-2-yloxy)octane-2,5-dione (CID 70609044) is 1-cyclopentyl-1,8-bis(2-methoxypropan-2-yloxy)octane-2,5-dione.
What is the SMILES notation for 1-cyclopentyl-1,8-bis(2-methoxypropan-2-yloxy)octane-2,5-dione?
The canonical SMILES for 1-cyclopentyl-1,8-bis(2-methoxypropan-2-yloxy)octane-2,5-dione is COC(C)(C)OCCCC(=O)CCC(=O)C(OC(C)(C)OC)C1CCCC1.
What is the InChIKey of 1-cyclopentyl-1,8-bis(2-methoxypropan-2-yloxy)octane-2,5-dione?
The InChIKey is MJDPFTFUPTYPKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38O6/c1-20(2,24-5)26-15-9-12-17(22)13-14-18(23)19(16-10-7-8-11-16)27-21(3,4)25-6/h16,19H,7-15H2,1-6H3.
What are the key properties of 1-cyclopentyl-1,8-bis(2-methoxypropan-2-yloxy)octane-2,5-dione?
1-cyclopentyl-1,8-bis(2-methoxypropan-2-yloxy)octane-2,5-dione has a molecular weight of 386.53 g/mol, XLogP of 4.04, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-1,8-bis(2-methoxypropan-2-yloxy)octane-2,5-dione is sourced from PubChem (CID 70609044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).