C26H43NO2 — CID 70609932
(6aR,10aS)-9-(ethylamino)-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,9,10-tetrahydro-6aH-benzo[c]chromen-10a-ol (PubChem CID 70609932) has the molecular formula C26H43NO2 and a molecular weight of 401.64 g/mol. Its IUPAC name is (6aR,10aS)-9-(ethylamino)-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,9,10-tetrahydro-6aH-benzo[c]chromen-10a-ol.
| Compound Name | (6aR,10aS)-9-(ethylamino)-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,9,10-tetrahydro-6aH-benzo[c]chromen-10a-ol |
|---|---|
| PubChem CID | 70609932 |
| Molecular Formula | C26H43NO2 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.33 |
| IUPAC Name | (6aR,10aS)-9-(ethylamino)-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,9,10-tetrahydro-6aH-benzo[c]chromen-10a-ol |
| SMILES | CCCCCCC(C)(C)c1ccc2c(c1)OC(C)(C)[C@@H]1CCC(NCC)C[C@@]21O |
| InChI | InChI=1S/C26H43NO2/c1-7-9-10-11-16-24(3,4)19-12-14-21-22(17-19)29-25(5,6)23-15-13-20(27-8-2)18-26(21,23)28/h12,14,17,20,23,27-28H,7-11,13,15-16,18H2,1-6H3/t20?,23-,26+/m0/s1 |
| InChIKey | RSDAOWBGMKUEHL-AFGVXUNXSA-N |
| XLogP | 6.07 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|