C22H32O6 — CID 70610300
ethyl 9-[(1S,6S)-1-hydroxy-2,2,6-trimethylcyclohexyl]-3,7-dimethyl-2,4,6-trioxonon-8-ynoate (PubChem CID 70610300) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is ethyl 9-[(1S,6S)-1-hydroxy-2,2,6-trimethylcyclohexyl]-3,7-dimethyl-2,4,6-trioxonon-8-ynoate.
| Compound Name | ethyl 9-[(1S,6S)-1-hydroxy-2,2,6-trimethylcyclohexyl]-3,7-dimethyl-2,4,6-trioxonon-8-ynoate |
|---|---|
| PubChem CID | 70610300 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | ethyl 9-[(1S,6S)-1-hydroxy-2,2,6-trimethylcyclohexyl]-3,7-dimethyl-2,4,6-trioxonon-8-ynoate |
| SMILES | CCOC(=O)C(=O)C(C)C(=O)CC(=O)C(C)C#C[C@]1(O)[C@@H](C)CCCC1(C)C |
| InChI | InChI=1S/C22H32O6/c1-7-28-20(26)19(25)16(4)18(24)13-17(23)14(2)10-12-22(27)15(3)9-8-11-21(22,5)6/h14-16,27H,7-9,11,13H2,1-6H3/t14?,15-,16?,22-/m0/s1 |
| InChIKey | HYQYQZIPZGRUMQ-TZGZVVABSA-N |
| XLogP | 2.50 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|