C22H27ClN2O3 — CID 70610508
1-[(1S,10S,12R,13S,14R,16S,17S,18R)-8-(chloromethyl)-13-ethyl-14,18-dihydroxy-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-9-yl]ethanone (PubChem CID 70610508) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is 1-[(1S,10S,12R,13S,14R,16S,17S,18R)-8-(chloromethyl)-13-ethyl-14,18-dihydroxy-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-9-yl]ethanone.
| Compound Name | 1-[(1S,10S,12R,13S,14R,16S,17S,18R)-8-(chloromethyl)-13-ethyl-14,18-dihydroxy-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-9-yl]ethanone |
|---|---|
| PubChem CID | 70610508 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-[(1S,10S,12R,13S,14R,16S,17S,18R)-8-(chloromethyl)-13-ethyl-14,18-dihydroxy-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-9-yl]ethanone |
| SMILES | CC[C@H]1[C@@H]2C[C@@H]3N([C@@H]1O)[C@H]1C[C@@]4(c5ccccc5N(CCl)C34C(C)=O)[C@H](O)[C@@H]21 |
| InChI | InChI=1S/C22H27ClN2O3/c1-3-12-13-8-17-22(11(2)26)21(14-6-4-5-7-15(14)24(22)10-23)9-16(18(13)19(21)27)25(17)20(12)28/h4-7,12-13,16-20,27-28H,3,8-10H2,1-2H3/t12-,13-,16-,17-,18-,19+,20+,21+,22?/m0/s1 |
| InChIKey | FKBSSZVFYJYFGH-LEFVQANYSA-N |
| XLogP | 2.08 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|