About N-[6,6-diamino-3-(diethylamino)cyclohexa-2,4-dien-1-yl]acetamide
N-[6,6-diamino-3-(diethylamino)cyclohexa-2,4-dien-1-yl]acetamide (PubChem CID 70610541) has the molecular formula C12H22N4O
and a molecular weight of 238.33 g/mol. Its IUPAC name is N-[6,6-diamino-3-(diethylamino)cyclohexa-2,4-dien-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[6,6-diamino-3-(diethylamino)cyclohexa-2,4-dien-1-yl]acetamide |
| PubChem CID | 70610541 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | N-[6,6-diamino-3-(diethylamino)cyclohexa-2,4-dien-1-yl]acetamide |
| SMILES | CCN(CC)C1=CC(NC(C)=O)C(N)(N)C=C1 |
| InChI | InChI=1S/C12H22N4O/c1-4-16(5-2)10-6-7-12(13,14)11(8-10)15-9(3)17/h6-8,11H,4-5,13-14H2,1-3H3,(H,15,17) |
| InChIKey | PZSRTYTWPCBOFS-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[6,6-diamino-3-(diethylamino)cyclohexa-2,4-dien-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6,6-diamino-3-(diethylamino)cyclohexa-2,4-dien-1-yl]acetamide?
The IUPAC name of N-[6,6-diamino-3-(diethylamino)cyclohexa-2,4-dien-1-yl]acetamide (CID 70610541) is N-[6,6-diamino-3-(diethylamino)cyclohexa-2,4-dien-1-yl]acetamide.
What is the SMILES notation for N-[6,6-diamino-3-(diethylamino)cyclohexa-2,4-dien-1-yl]acetamide?
The canonical SMILES for N-[6,6-diamino-3-(diethylamino)cyclohexa-2,4-dien-1-yl]acetamide is CCN(CC)C1=CC(NC(C)=O)C(N)(N)C=C1.
What is the InChIKey of N-[6,6-diamino-3-(diethylamino)cyclohexa-2,4-dien-1-yl]acetamide?
The InChIKey is PZSRTYTWPCBOFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O/c1-4-16(5-2)10-6-7-12(13,14)11(8-10)15-9(3)17/h6-8,11H,4-5,13-14H2,1-3H3,(H,15,17).
What are the key properties of N-[6,6-diamino-3-(diethylamino)cyclohexa-2,4-dien-1-yl]acetamide?
N-[6,6-diamino-3-(diethylamino)cyclohexa-2,4-dien-1-yl]acetamide has a molecular weight of 238.33 g/mol, XLogP of -0.10, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6,6-diamino-3-(diethylamino)cyclohexa-2,4-dien-1-yl]acetamide is sourced from PubChem (CID 70610541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).