C12H12Br4O4 — CID 70610556
3,4,5,6-tetrabromo-1,2-diethylcyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 70610556) has the molecular formula C12H12Br4O4 and a molecular weight of 539.84 g/mol. Its IUPAC name is 3,4,5,6-tetrabromo-1,2-diethylcyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | 3,4,5,6-tetrabromo-1,2-diethylcyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 70610556 |
| Molecular Formula | C12H12Br4O4 |
| Molecular Weight | 539.84 g/mol |
| Exact Mass | 535.75 |
| IUPAC Name | 3,4,5,6-tetrabromo-1,2-diethylcyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | CCC1(C(=O)O)C(Br)=C(Br)C(Br)=C(Br)C1(CC)C(=O)O |
| InChI | InChI=1S/C12H12Br4O4/c1-3-11(9(17)18)7(15)5(13)6(14)8(16)12(11,4-2)10(19)20/h3-4H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | ADIKPKQKSBNVOT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.84 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |