About dichlorocopper;7-methyl-1H-1,8-naphthyridin-4-one
dichlorocopper;7-methyl-1H-1,8-naphthyridin-4-one (PubChem CID 70610790) has the molecular formula C9H8Cl2CuN2O
and a molecular weight of 294.63 g/mol. Its IUPAC name is dichlorocopper;7-methyl-1H-1,8-naphthyridin-4-one.
Molecular Properties
| Compound Name | dichlorocopper;7-methyl-1H-1,8-naphthyridin-4-one |
| PubChem CID | 70610790 |
| Molecular Formula | C9H8Cl2CuN2O |
| Molecular Weight | 294.63 g/mol |
| Exact Mass | 292.93 |
| IUPAC Name | dichlorocopper;7-methyl-1H-1,8-naphthyridin-4-one |
| SMILES | Cc1ccc2c(=O)cc[nH]c2n1.Cl[Cu]Cl |
| InChI | InChI=1S/C9H8N2O.2ClH.Cu/c1-6-2-3-7-8(12)4-5-10-9(7)11-6;;;/h2-5H,1H3,(H,10,11,12);2*1H;/q;;;+2/p-2 |
| InChIKey | AJXKDZGNBSUOLR-UHFFFAOYSA-L |
| XLogP | 2.61 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.63 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dichlorocopper;7-methyl-1H-1,8-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorocopper;7-methyl-1H-1,8-naphthyridin-4-one?
The IUPAC name of dichlorocopper;7-methyl-1H-1,8-naphthyridin-4-one (CID 70610790) is dichlorocopper;7-methyl-1H-1,8-naphthyridin-4-one.
What is the SMILES notation for dichlorocopper;7-methyl-1H-1,8-naphthyridin-4-one?
The canonical SMILES for dichlorocopper;7-methyl-1H-1,8-naphthyridin-4-one is Cc1ccc2c(=O)cc[nH]c2n1.Cl[Cu]Cl.
What is the InChIKey of dichlorocopper;7-methyl-1H-1,8-naphthyridin-4-one?
The InChIKey is AJXKDZGNBSUOLR-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H8N2O.2ClH.Cu/c1-6-2-3-7-8(12)4-5-10-9(7)11-6;;;/h2-5H,1H3,(H,10,11,12);2*1H;/q;;;+2/p-2.
What are the key properties of dichlorocopper;7-methyl-1H-1,8-naphthyridin-4-one?
dichlorocopper;7-methyl-1H-1,8-naphthyridin-4-one has a molecular weight of 294.63 g/mol, XLogP of 2.61, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocopper;7-methyl-1H-1,8-naphthyridin-4-one is sourced from PubChem (CID 70610790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).