C6H12O2 — CID 70611170
[(1S)-2,2-dimethylcyclopropyl]methanediol (PubChem CID 70611170) has the molecular formula C6H12O2 and a molecular weight of 116.16 g/mol. Its IUPAC name is [(1S)-2,2-dimethylcyclopropyl]methanediol.
| Compound Name | [(1S)-2,2-dimethylcyclopropyl]methanediol |
|---|---|
| PubChem CID | 70611170 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | [(1S)-2,2-dimethylcyclopropyl]methanediol |
| SMILES | CC1(C)C[C@@H]1C(O)O |
| InChI | InChI=1S/C6H12O2/c1-6(2)3-4(6)5(7)8/h4-5,7-8H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | CULVXXWOHIUDDN-SCSAIBSYSA-N |
| XLogP | 0.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|