About [(1S)-2,2-dimethylcyclopropyl]methanediol
[(1S)-2,2-dimethylcyclopropyl]methanediol (PubChem CID 70611170) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is [(1S)-2,2-dimethylcyclopropyl]methanediol.
Molecular Properties
| Compound Name | [(1S)-2,2-dimethylcyclopropyl]methanediol |
| PubChem CID | 70611170 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | [(1S)-2,2-dimethylcyclopropyl]methanediol |
| SMILES | CC1(C)C[C@@H]1C(O)O |
| InChI | InChI=1S/C6H12O2/c1-6(2)3-4(6)5(7)8/h4-5,7-8H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | CULVXXWOHIUDDN-SCSAIBSYSA-N |
| XLogP | 0.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-2,2-dimethylcyclopropyl]methanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2,2-dimethylcyclopropyl]methanediol?
The IUPAC name of [(1S)-2,2-dimethylcyclopropyl]methanediol (CID 70611170) is [(1S)-2,2-dimethylcyclopropyl]methanediol.
What is the SMILES notation for [(1S)-2,2-dimethylcyclopropyl]methanediol?
The canonical SMILES for [(1S)-2,2-dimethylcyclopropyl]methanediol is CC1(C)C[C@@H]1C(O)O.
What is the InChIKey of [(1S)-2,2-dimethylcyclopropyl]methanediol?
The InChIKey is CULVXXWOHIUDDN-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H12O2/c1-6(2)3-4(6)5(7)8/h4-5,7-8H,3H2,1-2H3/t4-/m1/s1.
What are the key properties of [(1S)-2,2-dimethylcyclopropyl]methanediol?
[(1S)-2,2-dimethylcyclopropyl]methanediol has a molecular weight of 116.16 g/mol, XLogP of 0.34, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2,2-dimethylcyclopropyl]methanediol is sourced from PubChem (CID 70611170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).