About dichlorozinc;5,7-dimethyl-1,8-naphthyridin-2-amine
dichlorozinc;5,7-dimethyl-1,8-naphthyridin-2-amine (PubChem CID 70611232) has the molecular formula C10H11Cl2N3Zn
and a molecular weight of 309.52 g/mol. Its IUPAC name is dichlorozinc;5,7-dimethyl-1,8-naphthyridin-2-amine.
Molecular Properties
| Compound Name | dichlorozinc;5,7-dimethyl-1,8-naphthyridin-2-amine |
| PubChem CID | 70611232 |
| Molecular Formula | C10H11Cl2N3Zn |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | dichlorozinc;5,7-dimethyl-1,8-naphthyridin-2-amine |
| SMILES | Cc1cc(C)c2ccc(N)nc2n1.Cl[Zn]Cl |
| InChI | InChI=1S/C10H11N3.2ClH.Zn/c1-6-5-7(2)12-10-8(6)3-4-9(11)13-10;;;/h3-5H,1-2H3,(H2,11,12,13);2*1H;/q;;;+2/p-2 |
| InChIKey | PPVOWCRPRFDVTE-UHFFFAOYSA-L |
| XLogP | 3.21 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichlorozinc;5,7-dimethyl-1,8-naphthyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozinc;5,7-dimethyl-1,8-naphthyridin-2-amine?
The IUPAC name of dichlorozinc;5,7-dimethyl-1,8-naphthyridin-2-amine (CID 70611232) is dichlorozinc;5,7-dimethyl-1,8-naphthyridin-2-amine.
What is the SMILES notation for dichlorozinc;5,7-dimethyl-1,8-naphthyridin-2-amine?
The canonical SMILES for dichlorozinc;5,7-dimethyl-1,8-naphthyridin-2-amine is Cc1cc(C)c2ccc(N)nc2n1.Cl[Zn]Cl.
What is the InChIKey of dichlorozinc;5,7-dimethyl-1,8-naphthyridin-2-amine?
The InChIKey is PPVOWCRPRFDVTE-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H11N3.2ClH.Zn/c1-6-5-7(2)12-10-8(6)3-4-9(11)13-10;;;/h3-5H,1-2H3,(H2,11,12,13);2*1H;/q;;;+2/p-2.
What are the key properties of dichlorozinc;5,7-dimethyl-1,8-naphthyridin-2-amine?
dichlorozinc;5,7-dimethyl-1,8-naphthyridin-2-amine has a molecular weight of 309.52 g/mol, XLogP of 3.21, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozinc;5,7-dimethyl-1,8-naphthyridin-2-amine is sourced from PubChem (CID 70611232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).