C23H24N2 — CID 70611238
1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene;1-azatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,10-pentaene (PubChem CID 70611238) has the molecular formula C23H24N2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene;1-azatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,10-pentaene.
| Compound Name | 1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene;1-azatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,10-pentaene |
|---|---|
| PubChem CID | 70611238 |
| Molecular Formula | C23H24N2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene;1-azatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,10-pentaene |
| SMILES | C1=CN2CC=Cc3cccc(c32)C1.c1cc2c3c(c1)CCN3CCC2 |
| InChI | InChI=1S/C12H11N.C11H13N/c1-4-10-6-2-8-13-9-3-7-11(5-1)12(10)13;1-3-9-5-2-7-12-8-6-10(4-1)11(9)12/h1-6,9H,7-8H2;1,3-4H,2,5-8H2 |
| InChIKey | WLPNYYNYTPVBHM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |