C14H10Cl2N2 — CID 70611395
2-[(6-amino-2,3-dichlorophenyl)methyl]benzonitrile (PubChem CID 70611395) has the molecular formula C14H10Cl2N2 and a molecular weight of 277.15 g/mol. Its IUPAC name is 2-[(6-amino-2,3-dichlorophenyl)methyl]benzonitrile.
| Compound Name | 2-[(6-amino-2,3-dichlorophenyl)methyl]benzonitrile |
|---|---|
| PubChem CID | 70611395 |
| Molecular Formula | C14H10Cl2N2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 2-[(6-amino-2,3-dichlorophenyl)methyl]benzonitrile |
| SMILES | N#Cc1ccccc1Cc1c(N)ccc(Cl)c1Cl |
| InChI | InChI=1S/C14H10Cl2N2/c15-12-5-6-13(18)11(14(12)16)7-9-3-1-2-4-10(9)8-17/h1-6H,7,18H2 |
| InChIKey | HMTCWXMQKZXYRP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|