About 2-(prop-2-enylideneamino)-1,4-dihydropyridin-3-amine
2-(prop-2-enylideneamino)-1,4-dihydropyridin-3-amine (PubChem CID 70611479) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 2-(prop-2-enylideneamino)-1,4-dihydropyridin-3-amine.
Molecular Properties
| Compound Name | 2-(prop-2-enylideneamino)-1,4-dihydropyridin-3-amine |
| PubChem CID | 70611479 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 2-(prop-2-enylideneamino)-1,4-dihydropyridin-3-amine |
| SMILES | C=CC=NC1=C(N)CC=CN1 |
| InChI | InChI=1S/C8H11N3/c1-2-5-10-8-7(9)4-3-6-11-8/h2-3,5-6,11H,1,4,9H2 |
| InChIKey | DLSLDZUKGFSJAH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(prop-2-enylideneamino)-1,4-dihydropyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(prop-2-enylideneamino)-1,4-dihydropyridin-3-amine?
The IUPAC name of 2-(prop-2-enylideneamino)-1,4-dihydropyridin-3-amine (CID 70611479) is 2-(prop-2-enylideneamino)-1,4-dihydropyridin-3-amine.
What is the SMILES notation for 2-(prop-2-enylideneamino)-1,4-dihydropyridin-3-amine?
The canonical SMILES for 2-(prop-2-enylideneamino)-1,4-dihydropyridin-3-amine is C=CC=NC1=C(N)CC=CN1.
What is the InChIKey of 2-(prop-2-enylideneamino)-1,4-dihydropyridin-3-amine?
The InChIKey is DLSLDZUKGFSJAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-2-5-10-8-7(9)4-3-6-11-8/h2-3,5-6,11H,1,4,9H2.
What are the key properties of 2-(prop-2-enylideneamino)-1,4-dihydropyridin-3-amine?
2-(prop-2-enylideneamino)-1,4-dihydropyridin-3-amine has a molecular weight of 149.20 g/mol, XLogP of 0.88, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(prop-2-enylideneamino)-1,4-dihydropyridin-3-amine is sourced from PubChem (CID 70611479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).