C18H26O — CID 70611703
4,5,5,6,7,7-hexamethyl-1,6,8,9-tetrahydroindeno[2,1-c]pyran (PubChem CID 70611703) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 4,5,5,6,7,7-hexamethyl-1,6,8,9-tetrahydroindeno[2,1-c]pyran.
| Compound Name | 4,5,5,6,7,7-hexamethyl-1,6,8,9-tetrahydroindeno[2,1-c]pyran |
|---|---|
| PubChem CID | 70611703 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 4,5,5,6,7,7-hexamethyl-1,6,8,9-tetrahydroindeno[2,1-c]pyran |
| SMILES | CC1=COCC2=C1C1=C(C2)CC(C)(C)C(C)C1(C)C |
| InChI | InChI=1S/C18H26O/c1-11-9-19-10-14-7-13-8-17(3,4)12(2)18(5,6)16(13)15(11)14/h9,12H,7-8,10H2,1-6H3 |
| InChIKey | NHPXKDRTEWVDJE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |