C23H40N2O6 — CID 70611765
12-(2,5-dioxoimidazolidin-4-yl)-10-(oxan-2-yloxy)-8-propyldodecanoic acid (PubChem CID 70611765) has the molecular formula C23H40N2O6 and a molecular weight of 440.58 g/mol. Its IUPAC name is 12-(2,5-dioxoimidazolidin-4-yl)-10-(oxan-2-yloxy)-8-propyldodecanoic acid.
| Compound Name | 12-(2,5-dioxoimidazolidin-4-yl)-10-(oxan-2-yloxy)-8-propyldodecanoic acid |
|---|---|
| PubChem CID | 70611765 |
| Molecular Formula | C23H40N2O6 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 12-(2,5-dioxoimidazolidin-4-yl)-10-(oxan-2-yloxy)-8-propyldodecanoic acid |
| SMILES | CCCC(CCCCCCC(=O)O)CC(CCC1NC(=O)NC1=O)OC1CCCCO1 |
| InChI | InChI=1S/C23H40N2O6/c1-2-9-17(10-5-3-4-6-11-20(26)27)16-18(31-21-12-7-8-15-30-21)13-14-19-22(28)25-23(29)24-19/h17-19,21H,2-16H2,1H3,(H,26,27)(H2,24,25,28,29) |
| InChIKey | FVCCOZFOKVCYQP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|