About 2-methylpropyl N-[(3,4,5-trimethoxyphenyl)methyl]carbamate
2-methylpropyl N-[(3,4,5-trimethoxyphenyl)methyl]carbamate (PubChem CID 706120) has the molecular formula C15H23NO5
and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-methylpropyl N-[(3,4,5-trimethoxyphenyl)methyl]carbamate.
Molecular Properties
| Compound Name | 2-methylpropyl N-[(3,4,5-trimethoxyphenyl)methyl]carbamate |
| PubChem CID | 706120 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-methylpropyl N-[(3,4,5-trimethoxyphenyl)methyl]carbamate |
| SMILES | COc1cc(CNC(=O)OCC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C15H23NO5/c1-10(2)9-21-15(17)16-8-11-6-12(18-3)14(20-5)13(7-11)19-4/h6-7,10H,8-9H2,1-5H3,(H,16,17) |
| InChIKey | OEFLVQUBOAWACA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylpropyl N-[(3,4,5-trimethoxyphenyl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-[(3,4,5-trimethoxyphenyl)methyl]carbamate?
The IUPAC name of 2-methylpropyl N-[(3,4,5-trimethoxyphenyl)methyl]carbamate (CID 706120) is 2-methylpropyl N-[(3,4,5-trimethoxyphenyl)methyl]carbamate.
What is the SMILES notation for 2-methylpropyl N-[(3,4,5-trimethoxyphenyl)methyl]carbamate?
The canonical SMILES for 2-methylpropyl N-[(3,4,5-trimethoxyphenyl)methyl]carbamate is COc1cc(CNC(=O)OCC(C)C)cc(OC)c1OC.
What is the InChIKey of 2-methylpropyl N-[(3,4,5-trimethoxyphenyl)methyl]carbamate?
The InChIKey is OEFLVQUBOAWACA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO5/c1-10(2)9-21-15(17)16-8-11-6-12(18-3)14(20-5)13(7-11)19-4/h6-7,10H,8-9H2,1-5H3,(H,16,17).
What are the key properties of 2-methylpropyl N-[(3,4,5-trimethoxyphenyl)methyl]carbamate?
2-methylpropyl N-[(3,4,5-trimethoxyphenyl)methyl]carbamate has a molecular weight of 297.35 g/mol, XLogP of 2.59, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-[(3,4,5-trimethoxyphenyl)methyl]carbamate is sourced from PubChem (CID 706120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).