3-oxo-4H-1,4-benzoxazine-6-carboxylic acid

C9H7NO4 — CID 706121

IUPAC3-oxo-4H-1,4-benzoxazine-6-carboxylic acid
SMILESO=C1COc2ccc(C(=O)O)cc2N1
InChIInChI=1S/C9H7NO4/c11-8-4-14-7-2-1-5(9(12)13)3-6(7)10-8/h1-3H,4H2,(H,10,11)(H,12,13)
InChIKeyCIYUDMUBYRVMLP-UHFFFAOYSA-N
MW193.16 g/mol
LogP0.72
Rot. Bonds1

About 3-oxo-4H-1,4-benzoxazine-6-carboxylic acid

3-oxo-4H-1,4-benzoxazine-6-carboxylic acid (PubChem CID 706121) has the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. Its IUPAC name is 3-oxo-4H-1,4-benzoxazine-6-carboxylic acid.

Molecular Properties

Compound Name3-oxo-4H-1,4-benzoxazine-6-carboxylic acid
PubChem CID706121
Molecular FormulaC9H7NO4
Molecular Weight193.16 g/mol
Exact Mass193.04
IUPAC Name3-oxo-4H-1,4-benzoxazine-6-carboxylic acid
SMILESO=C1COc2ccc(C(=O)O)cc2N1
InChIInChI=1S/C9H7NO4/c11-8-4-14-7-2-1-5(9(12)13)3-6(7)10-8/h1-3H,4H2,(H,10,11)(H,12,13)
InChIKeyCIYUDMUBYRVMLP-UHFFFAOYSA-N
XLogP0.72
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.16
LogP ≤ 50.72
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-oxo-4H-1,4-benzoxazine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-oxo-4H-1,4-benzoxazine-6-carboxylic acid?
The IUPAC name of 3-oxo-4H-1,4-benzoxazine-6-carboxylic acid (CID 706121) is 3-oxo-4H-1,4-benzoxazine-6-carboxylic acid.
What is the SMILES notation for 3-oxo-4H-1,4-benzoxazine-6-carboxylic acid?
The canonical SMILES for 3-oxo-4H-1,4-benzoxazine-6-carboxylic acid is O=C1COc2ccc(C(=O)O)cc2N1.
What is the InChIKey of 3-oxo-4H-1,4-benzoxazine-6-carboxylic acid?
The InChIKey is CIYUDMUBYRVMLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO4/c11-8-4-14-7-2-1-5(9(12)13)3-6(7)10-8/h1-3H,4H2,(H,10,11)(H,12,13).
What are the key properties of 3-oxo-4H-1,4-benzoxazine-6-carboxylic acid?
3-oxo-4H-1,4-benzoxazine-6-carboxylic acid has a molecular weight of 193.16 g/mol, XLogP of 0.72, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-4H-1,4-benzoxazine-6-carboxylic acid is sourced from PubChem (CID 706121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).