C16H19N3O6 — CID 70612127
methyl 5-(3-cyclohexyl-2,4,5-trioxoimidazolidin-1-yl)-3-ethyl-1,2-oxazole-4-carboxylate (PubChem CID 70612127) has the molecular formula C16H19N3O6 and a molecular weight of 349.34 g/mol. Its IUPAC name is methyl 5-(3-cyclohexyl-2,4,5-trioxoimidazolidin-1-yl)-3-ethyl-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 5-(3-cyclohexyl-2,4,5-trioxoimidazolidin-1-yl)-3-ethyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 70612127 |
| Molecular Formula | C16H19N3O6 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | methyl 5-(3-cyclohexyl-2,4,5-trioxoimidazolidin-1-yl)-3-ethyl-1,2-oxazole-4-carboxylate |
| SMILES | CCc1noc(N2C(=O)C(=O)N(C3CCCCC3)C2=O)c1C(=O)OC |
| InChI | InChI=1S/C16H19N3O6/c1-3-10-11(15(22)24-2)14(25-17-10)19-13(21)12(20)18(16(19)23)9-7-5-4-6-8-9/h9H,3-8H2,1-2H3 |
| InChIKey | FRUPPDIBVOCYII-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 110.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|