C24H37NO2 — CID 70612152
N,N-diethyl-2-[(8S,9S,10R,13S,14S)-10-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-13-yl]acetamide (PubChem CID 70612152) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is N,N-diethyl-2-[(8S,9S,10R,13S,14S)-10-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-13-yl]acetamide.
| Compound Name | N,N-diethyl-2-[(8S,9S,10R,13S,14S)-10-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-13-yl]acetamide |
|---|---|
| PubChem CID | 70612152 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | N,N-diethyl-2-[(8S,9S,10R,13S,14S)-10-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-13-yl]acetamide |
| SMILES | CCN(CC)C(=O)C[C@@]12CCC[C@H]1[C@@H]1CCC3=CC(=O)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C24H37NO2/c1-4-25(5-2)22(27)16-24-12-6-7-21(24)19-9-8-17-15-18(26)10-13-23(17,3)20(19)11-14-24/h15,19-21H,4-14,16H2,1-3H3/t19-,20+,21+,23+,24+/m1/s1 |
| InChIKey | YNLJBCXQSDPECN-HFTXWFNKSA-N |
| XLogP | 5.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |