C23H23NO2S — CID 70612205
2-benzhydryl-1-(3-methylphenyl)sulfonylazetidine (PubChem CID 70612205) has the molecular formula C23H23NO2S and a molecular weight of 377.51 g/mol. Its IUPAC name is 2-benzhydryl-1-(3-methylphenyl)sulfonylazetidine.
| Compound Name | 2-benzhydryl-1-(3-methylphenyl)sulfonylazetidine |
|---|---|
| PubChem CID | 70612205 |
| Molecular Formula | C23H23NO2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-benzhydryl-1-(3-methylphenyl)sulfonylazetidine |
| SMILES | Cc1cccc(S(=O)(=O)N2CCC2C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H23NO2S/c1-18-9-8-14-21(17-18)27(25,26)24-16-15-22(24)23(19-10-4-2-5-11-19)20-12-6-3-7-13-20/h2-14,17,22-23H,15-16H2,1H3 |
| InChIKey | KKIHDKCXHHQJRP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |