About 1-(3,3-dimethyl-2-bicyclo[2.2.1]hept-1-enyl)-3-methoxyhexan-1-one
1-(3,3-dimethyl-2-bicyclo[2.2.1]hept-1-enyl)-3-methoxyhexan-1-one (PubChem CID 70612503) has the molecular formula C16H26O2
and a molecular weight of 250.38 g/mol. Its IUPAC name is 1-(3,3-dimethyl-2-bicyclo[2.2.1]hept-1-enyl)-3-methoxyhexan-1-one.
Molecular Properties
| Compound Name | 1-(3,3-dimethyl-2-bicyclo[2.2.1]hept-1-enyl)-3-methoxyhexan-1-one |
| PubChem CID | 70612503 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1-(3,3-dimethyl-2-bicyclo[2.2.1]hept-1-enyl)-3-methoxyhexan-1-one |
| SMILES | CCCC(CC(=O)C1=C2CCC(C2)C1(C)C)OC |
| InChI | InChI=1S/C16H26O2/c1-5-6-13(18-4)10-14(17)15-11-7-8-12(9-11)16(15,2)3/h12-13H,5-10H2,1-4H3 |
| InChIKey | DOJANCXYOSJZDF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,3-dimethyl-2-bicyclo[2.2.1]hept-1-enyl)-3-methoxyhexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethyl-2-bicyclo[2.2.1]hept-1-enyl)-3-methoxyhexan-1-one?
The IUPAC name of 1-(3,3-dimethyl-2-bicyclo[2.2.1]hept-1-enyl)-3-methoxyhexan-1-one (CID 70612503) is 1-(3,3-dimethyl-2-bicyclo[2.2.1]hept-1-enyl)-3-methoxyhexan-1-one.
What is the SMILES notation for 1-(3,3-dimethyl-2-bicyclo[2.2.1]hept-1-enyl)-3-methoxyhexan-1-one?
The canonical SMILES for 1-(3,3-dimethyl-2-bicyclo[2.2.1]hept-1-enyl)-3-methoxyhexan-1-one is CCCC(CC(=O)C1=C2CCC(C2)C1(C)C)OC.
What is the InChIKey of 1-(3,3-dimethyl-2-bicyclo[2.2.1]hept-1-enyl)-3-methoxyhexan-1-one?
The InChIKey is DOJANCXYOSJZDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O2/c1-5-6-13(18-4)10-14(17)15-11-7-8-12(9-11)16(15,2)3/h12-13H,5-10H2,1-4H3.
What are the key properties of 1-(3,3-dimethyl-2-bicyclo[2.2.1]hept-1-enyl)-3-methoxyhexan-1-one?
1-(3,3-dimethyl-2-bicyclo[2.2.1]hept-1-enyl)-3-methoxyhexan-1-one has a molecular weight of 250.38 g/mol, XLogP of 3.90, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethyl-2-bicyclo[2.2.1]hept-1-enyl)-3-methoxyhexan-1-one is sourced from PubChem (CID 70612503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).