C31H50O8 — CID 70612607
(Z)-7-[(1R,2R)-2-[(E)-4-methyl-4-propoxypent-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)hept-5-enoic acid (PubChem CID 70612607) has the molecular formula C31H50O8 and a molecular weight of 550.73 g/mol. Its IUPAC name is (Z)-7-[(1R,2R)-2-[(E)-4-methyl-4-propoxypent-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R)-2-[(E)-4-methyl-4-propoxypent-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)hept-5-enoic acid |
|---|---|
| PubChem CID | 70612607 |
| Molecular Formula | C31H50O8 |
| Molecular Weight | 550.73 g/mol |
| Exact Mass | 550.35 |
| IUPAC Name | (Z)-7-[(1R,2R)-2-[(E)-4-methyl-4-propoxypent-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)hept-5-enoic acid |
| SMILES | CCCOC(C)(C)C/C=C/[C@H]1CCC(=O)[C@@H]1C/C=C\CCC(OC1CCCCO1)(OC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C31H50O8/c1-4-21-37-30(2,3)19-12-13-24-17-18-26(32)25(24)14-6-5-9-20-31(29(33)34,38-27-15-7-10-22-35-27)39-28-16-8-11-23-36-28/h5-6,12-13,24-25,27-28H,4,7-11,14-23H2,1-3H3,(H,33,34)/b6-5-,13-12+/t24-,25+,27?,28?,31?/m0/s1 |
| InChIKey | SAVQONZRBOBDPE-WLLGAQFUSA-N |
| XLogP | 6.33 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.73 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|