About 4-ethyl-3-methylpyrazolo[5,4-c]isoquinolin-5-one
4-ethyl-3-methylpyrazolo[5,4-c]isoquinolin-5-one (PubChem CID 70613500) has the molecular formula C13H13N3O
and a molecular weight of 227.27 g/mol. Its IUPAC name is 4-ethyl-3-methylpyrazolo[5,4-c]isoquinolin-5-one.
Molecular Properties
| Compound Name | 4-ethyl-3-methylpyrazolo[5,4-c]isoquinolin-5-one |
| PubChem CID | 70613500 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-ethyl-3-methylpyrazolo[5,4-c]isoquinolin-5-one |
| SMILES | CCn1c(=O)c2ccccc2c2cnn(C)c21 |
| InChI | InChI=1S/C13H13N3O/c1-3-16-12-11(8-14-15(12)2)9-6-4-5-7-10(9)13(16)17/h4-8H,3H2,1-2H3 |
| InChIKey | HCXNSCVHGFSJRA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethyl-3-methylpyrazolo[5,4-c]isoquinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-3-methylpyrazolo[5,4-c]isoquinolin-5-one?
The IUPAC name of 4-ethyl-3-methylpyrazolo[5,4-c]isoquinolin-5-one (CID 70613500) is 4-ethyl-3-methylpyrazolo[5,4-c]isoquinolin-5-one.
What is the SMILES notation for 4-ethyl-3-methylpyrazolo[5,4-c]isoquinolin-5-one?
The canonical SMILES for 4-ethyl-3-methylpyrazolo[5,4-c]isoquinolin-5-one is CCn1c(=O)c2ccccc2c2cnn(C)c21.
What is the InChIKey of 4-ethyl-3-methylpyrazolo[5,4-c]isoquinolin-5-one?
The InChIKey is HCXNSCVHGFSJRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O/c1-3-16-12-11(8-14-15(12)2)9-6-4-5-7-10(9)13(16)17/h4-8H,3H2,1-2H3.
What are the key properties of 4-ethyl-3-methylpyrazolo[5,4-c]isoquinolin-5-one?
4-ethyl-3-methylpyrazolo[5,4-c]isoquinolin-5-one has a molecular weight of 227.27 g/mol, XLogP of 1.91, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-3-methylpyrazolo[5,4-c]isoquinolin-5-one is sourced from PubChem (CID 70613500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).