About (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetonitrile
(2Z)-2-(1,4-benzodiazepin-2-ylidene)acetonitrile (PubChem CID 70614081) has the molecular formula C11H7N3
and a molecular weight of 181.20 g/mol. Its IUPAC name is (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetonitrile.
Molecular Properties
| Compound Name | (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetonitrile |
| PubChem CID | 70614081 |
| Molecular Formula | C11H7N3 |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetonitrile |
| SMILES | N#C/C=C1/C=NC=c2ccccc2=N1 |
| InChI | InChI=1S/C11H7N3/c12-6-5-10-8-13-7-9-3-1-2-4-11(9)14-10/h1-5,7-8H/b10-5- |
| InChIKey | DAASTDFNLASTNS-YHYXMXQVSA-N |
| XLogP | 0.54 |
| TPSA | 48.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetonitrile?
The IUPAC name of (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetonitrile (CID 70614081) is (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetonitrile.
What is the SMILES notation for (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetonitrile?
The canonical SMILES for (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetonitrile is N#C/C=C1/C=NC=c2ccccc2=N1.
What is the InChIKey of (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetonitrile?
The InChIKey is DAASTDFNLASTNS-YHYXMXQVSA-N. The full InChI is InChI=1S/C11H7N3/c12-6-5-10-8-13-7-9-3-1-2-4-11(9)14-10/h1-5,7-8H/b10-5-.
What are the key properties of (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetonitrile?
(2Z)-2-(1,4-benzodiazepin-2-ylidene)acetonitrile has a molecular weight of 181.20 g/mol, XLogP of 0.54, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetonitrile is sourced from PubChem (CID 70614081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).