C12H12O8 — CID 70614098
1,5-bis(methoxycarbonyl)cyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 70614098) has the molecular formula C12H12O8 and a molecular weight of 284.22 g/mol. Its IUPAC name is 1,5-bis(methoxycarbonyl)cyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 1,5-bis(methoxycarbonyl)cyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 70614098 |
| Molecular Formula | C12H12O8 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 1,5-bis(methoxycarbonyl)cyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | COC(=O)C1=CC(C(=O)O)(C(=O)OC)CC(C(=O)O)=C1 |
| InChI | InChI=1S/C12H12O8/c1-19-9(15)7-3-6(8(13)14)4-12(5-7,10(16)17)11(18)20-2/h3,5H,4H2,1-2H3,(H,13,14)(H,16,17) |
| InChIKey | FLPLFRCNIVWQEP-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|