C22H36O3Si — CID 70614740
(8R,9R,10R,13S,14S)-13-methyl-10-(trimethylsilyloxymethyl)-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 70614740) has the molecular formula C22H36O3Si and a molecular weight of 376.61 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-13-methyl-10-(trimethylsilyloxymethyl)-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9R,10R,13S,14S)-13-methyl-10-(trimethylsilyloxymethyl)-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 70614740 |
| Molecular Formula | C22H36O3Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (8R,9R,10R,13S,14S)-13-methyl-10-(trimethylsilyloxymethyl)-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CC[C@@H]3[C@@H](CCC4CC(=O)CC[C@@]43CO[Si](C)(C)C)[C@@H]1CCC2=O |
| InChI | InChI=1S/C22H36O3Si/c1-21-11-10-19-17(18(21)7-8-20(21)24)6-5-15-13-16(23)9-12-22(15,19)14-25-26(2,3)4/h15,17-19H,5-14H2,1-4H3/t15?,17-,18-,19+,21-,22+/m0/s1 |
| InChIKey | HHNLWFISPXHJTC-CJCYJLBSSA-N |
| XLogP | 5.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|