About 2-cyclohexa-1,3-dien-1-yl-3-(4-methylphenyl)-1,4-oxathiine 4-oxide
2-cyclohexa-1,3-dien-1-yl-3-(4-methylphenyl)-1,4-oxathiine 4-oxide (PubChem CID 70615451) has the molecular formula C17H16O2S
and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-3-(4-methylphenyl)-1,4-oxathiine 4-oxide.
Molecular Properties
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-3-(4-methylphenyl)-1,4-oxathiine 4-oxide |
| PubChem CID | 70615451 |
| Molecular Formula | C17H16O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-3-(4-methylphenyl)-1,4-oxathiine 4-oxide |
| SMILES | Cc1ccc(C2=C(C3=CC=CCC3)OC=CS2=O)cc1 |
| InChI | InChI=1S/C17H16O2S/c1-13-7-9-15(10-8-13)17-16(19-11-12-20(17)18)14-5-3-2-4-6-14/h2-3,5,7-12H,4,6H2,1H3 |
| InChIKey | PDUNZVMXVNCVLR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexa-1,3-dien-1-yl-3-(4-methylphenyl)-1,4-oxathiine 4-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-1,3-dien-1-yl-3-(4-methylphenyl)-1,4-oxathiine 4-oxide?
The IUPAC name of 2-cyclohexa-1,3-dien-1-yl-3-(4-methylphenyl)-1,4-oxathiine 4-oxide (CID 70615451) is 2-cyclohexa-1,3-dien-1-yl-3-(4-methylphenyl)-1,4-oxathiine 4-oxide.
What is the SMILES notation for 2-cyclohexa-1,3-dien-1-yl-3-(4-methylphenyl)-1,4-oxathiine 4-oxide?
The canonical SMILES for 2-cyclohexa-1,3-dien-1-yl-3-(4-methylphenyl)-1,4-oxathiine 4-oxide is Cc1ccc(C2=C(C3=CC=CCC3)OC=CS2=O)cc1.
What is the InChIKey of 2-cyclohexa-1,3-dien-1-yl-3-(4-methylphenyl)-1,4-oxathiine 4-oxide?
The InChIKey is PDUNZVMXVNCVLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O2S/c1-13-7-9-15(10-8-13)17-16(19-11-12-20(17)18)14-5-3-2-4-6-14/h2-3,5,7-12H,4,6H2,1H3.
What are the key properties of 2-cyclohexa-1,3-dien-1-yl-3-(4-methylphenyl)-1,4-oxathiine 4-oxide?
2-cyclohexa-1,3-dien-1-yl-3-(4-methylphenyl)-1,4-oxathiine 4-oxide has a molecular weight of 284.38 g/mol, XLogP of 4.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-1,3-dien-1-yl-3-(4-methylphenyl)-1,4-oxathiine 4-oxide is sourced from PubChem (CID 70615451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).