C24H21NO2S — CID 70615473
1-amino-5-sulfanylanthracene-9,10-dione;1,2,3,4-tetrahydronaphthalene (PubChem CID 70615473) has the molecular formula C24H21NO2S and a molecular weight of 387.50 g/mol. Its IUPAC name is 1-amino-5-sulfanylanthracene-9,10-dione;1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-amino-5-sulfanylanthracene-9,10-dione;1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 70615473 |
| Molecular Formula | C24H21NO2S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-amino-5-sulfanylanthracene-9,10-dione;1,2,3,4-tetrahydronaphthalene |
| SMILES | Nc1cccc2c1C(=O)c1cccc(S)c1C2=O.c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C14H9NO2S.C10H12/c15-9-5-1-3-7-11(9)13(16)8-4-2-6-10(18)12(8)14(7)17;1-2-6-10-8-4-3-7-9(10)5-1/h1-6,18H,15H2;1-2,5-6H,3-4,7-8H2 |
| InChIKey | AGQWPUKDHANTFN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|