About 4-methylphenol;methylurea
4-methylphenol;methylurea (PubChem CID 70615521) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 4-methylphenol;methylurea.
Molecular Properties
| Compound Name | 4-methylphenol;methylurea |
| PubChem CID | 70615521 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 4-methylphenol;methylurea |
| SMILES | CNC(N)=O.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O.C2H6N2O/c1-6-2-4-7(8)5-3-6;1-4-2(3)5/h2-5,8H,1H3;1H3,(H3,3,4,5) |
| InChIKey | JOWSPISFUXZPPW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylphenol;methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylphenol;methylurea?
The IUPAC name of 4-methylphenol;methylurea (CID 70615521) is 4-methylphenol;methylurea.
What is the SMILES notation for 4-methylphenol;methylurea?
The canonical SMILES for 4-methylphenol;methylurea is CNC(N)=O.Cc1ccc(O)cc1.
What is the InChIKey of 4-methylphenol;methylurea?
The InChIKey is JOWSPISFUXZPPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C2H6N2O/c1-6-2-4-7(8)5-3-6;1-4-2(3)5/h2-5,8H,1H3;1H3,(H3,3,4,5).
What are the key properties of 4-methylphenol;methylurea?
4-methylphenol;methylurea has a molecular weight of 182.22 g/mol, XLogP of 0.99, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylphenol;methylurea is sourced from PubChem (CID 70615521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).