About 4-amino-2-phenylcyclohexa-1,5-diene-1,4-diol
4-amino-2-phenylcyclohexa-1,5-diene-1,4-diol (PubChem CID 70615537) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-amino-2-phenylcyclohexa-1,5-diene-1,4-diol.
Molecular Properties
| Compound Name | 4-amino-2-phenylcyclohexa-1,5-diene-1,4-diol |
| PubChem CID | 70615537 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 4-amino-2-phenylcyclohexa-1,5-diene-1,4-diol |
| SMILES | NC1(O)C=CC(O)=C(c2ccccc2)C1 |
| InChI | InChI=1S/C12H13NO2/c13-12(15)7-6-11(14)10(8-12)9-4-2-1-3-5-9/h1-7,14-15H,8,13H2 |
| InChIKey | ZDXCUOZNBYWYAI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-phenylcyclohexa-1,5-diene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-phenylcyclohexa-1,5-diene-1,4-diol?
The IUPAC name of 4-amino-2-phenylcyclohexa-1,5-diene-1,4-diol (CID 70615537) is 4-amino-2-phenylcyclohexa-1,5-diene-1,4-diol.
What is the SMILES notation for 4-amino-2-phenylcyclohexa-1,5-diene-1,4-diol?
The canonical SMILES for 4-amino-2-phenylcyclohexa-1,5-diene-1,4-diol is NC1(O)C=CC(O)=C(c2ccccc2)C1.
What is the InChIKey of 4-amino-2-phenylcyclohexa-1,5-diene-1,4-diol?
The InChIKey is ZDXCUOZNBYWYAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c13-12(15)7-6-11(14)10(8-12)9-4-2-1-3-5-9/h1-7,14-15H,8,13H2.
What are the key properties of 4-amino-2-phenylcyclohexa-1,5-diene-1,4-diol?
4-amino-2-phenylcyclohexa-1,5-diene-1,4-diol has a molecular weight of 203.24 g/mol, XLogP of 1.56, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-phenylcyclohexa-1,5-diene-1,4-diol is sourced from PubChem (CID 70615537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).